(+)-Leucocyanidin structure
|
Common Name | (+)-Leucocyanidin | ||
|---|---|---|---|---|
| CAS Number | 69256-15-1 | Molecular Weight | 306.27 | |
| Density | 1.709g/cm3 | Boiling Point | 641.5ºC at 760 mmHg | |
| Molecular Formula | C15H14O7 | Melting Point | >300 °C | |
| MSDS | N/A | Flash Point | 341.8ºC | |
Use of (+)-Leucocyanidin(+)-Leucocyanidin is the isoform of Leucocyanidin (HY-119580), is an active anti-ulcerogenic ingredient was extracted from Litchi Chinensis. Leucocyanidin demonstrates a significant protective effect against Aspirin-induced erosions in rat models[1]. |
| Name | (2R,3S,4R)-2-(3,4-Dihydroxyphenyl)-3,4,5,7-chromanetetrol |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Leucocyanidin is the isoform of Leucocyanidin (HY-119580), is an active anti-ulcerogenic ingredient was extracted from Litchi Chinensis. Leucocyanidin demonstrates a significant protective effect against Aspirin-induced erosions in rat models[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.709g/cm3 |
|---|---|
| Boiling Point | 641.5ºC at 760 mmHg |
| Melting Point | >300 °C |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 |
| Flash Point | 341.8ºC |
| Exact Mass | 306.07400 |
| PSA | 130.61000 |
| LogP | 1.03700 |
| Index of Refraction | 1.78 |
| InChIKey | SBZWTSHAFILOTE-QLFBSQMISA-N |
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (2R,3S)-2-amino-3-hydroxy-2-methylbutyric acid |
| 3,4-trans-leucocyanidin |
| (2R,3S)-2-methylthreonine |
| (2R,3S)-3-HYDROXY-D-ISOVALINE |
| (+)-Leucocyanidin |
| (2R,3S,4R)-leucocyanidin |
| (2R,3S,4R)-3,3',4,4',5,7-hexahydroxyflavan |
| (2R,3S,4R)-(+)-3,4,5,7,3',4'-hexahydroxyflavan |