3-hydroxy-3,4-diphenylbutan-2-one structure
|
Common Name | 3-hydroxy-3,4-diphenylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 69262-53-9 | Molecular Weight | 240.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-3,4-diphenylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O2 |
|---|---|
| Molecular Weight | 240.29700 |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 2.70590 |
| InChIKey | IYZOQJPJNQNAIX-UHFFFAOYSA-N |
| SMILES | CC(=O)C(O)(Cc1ccccc1)c1ccccc1 |
|
~2%
3-hydroxy-3,4-d... CAS#:69262-53-9 |
| Literature: Chantrapromma, Kan; Ollis, W. David; Sutherland, Ian O. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 5 p. 1049 - 1062 |
|
~33%
3-hydroxy-3,4-d... CAS#:69262-53-9 |
| Literature: Inaba, Shin-ichi; Rieke, Reuben D. Synthesis, 1984 , # 10 p. 844 - 845 |
|
~%
3-hydroxy-3,4-d... CAS#:69262-53-9 |
| Literature: Takuwa, Akio; Nishigaichi, Yutaka; Yamashita, Koichi; Iwamoto, Hidetoshi Chemistry Letters, 1990 , # 9 p. 1761 - 1764 |
| 2-hydroxy-1,2-diphenylbutan-3-one |
| 2-Butanone,3-hydroxy-3,4-diphenyl |
| 3,4-Diphenyl-3-hydroxy-2-butanone |