methyl 6-amino-5-cyano-2-methyl-4-(4-propan-2-yloxyphenyl)-4H-pyran-3-carboxylate structure
|
Common Name | methyl 6-amino-5-cyano-2-methyl-4-(4-propan-2-yloxyphenyl)-4H-pyran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6927-20-4 | Molecular Weight | 328.36200 | |
| Density | 1.22g/cm3 | Boiling Point | 529.8ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.2ºC | |
| Name | methyl 6-amino-5-cyano-2-methyl-4-(4-propan-2-yloxyphenyl)-4H-pyran-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 529.8ºC at 760 mmHg |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.36200 |
| Flash Point | 274.2ºC |
| Exact Mass | 328.14200 |
| PSA | 94.57000 |
| LogP | 3.42878 |
| Index of Refraction | 1.572 |
| InChIKey | QRNNXNVDBHSKNP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(OC(C)C)cc1 |
|
~%
methyl 6-amino-... CAS#:6927-20-4 |
| Literature: Skrypnik, Yu. G.; Lyashchuk, S. N. Journal of Organic Chemistry USSR (English Translation), 1992 , vol. 28, # 5.1 p. 695 - 700 Zhurnal Organicheskoi Khimii, 1992 , vol. 28, # 5 p. 906 - 911 |
|
~%
methyl 6-amino-... CAS#:6927-20-4 |
| Literature: Schall Journal fuer Praktische Chemie (Leipzig), 1893 , vol. <2> 48, p. 243 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phenyl Ethansulfonat |
| phenyl ethanesulfonate |
| ethanesulfonic acid phenyl ester |
| Aethansulfonsaeure-phenylester |