9,10-Anthracenedione, 1-amino-5-nitro structure
|
Common Name | 9,10-Anthracenedione, 1-amino-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 6937-75-3 | Molecular Weight | 268.22400 | |
| Density | 1.548g/cm3 | Boiling Point | 557.5ºC at 760 mmHg | |
| Molecular Formula | C14H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291ºC | |
| Name | 1-amino-5-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 557.5ºC at 760 mmHg |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.22400 |
| Flash Point | 291ºC |
| Exact Mass | 268.04800 |
| PSA | 105.98000 |
| LogP | 3.05680 |
| Index of Refraction | 1.734 |
| InChIKey | PHZPGLMKVOOUGI-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c1C(=O)c1cccc([N+](=O)[O-])c1C2=O |
|
~74%
9,10-Anthracene... CAS#:6937-75-3 |
| Literature: Bayer Aktiengesellschaft Patent: US4076736 A1, 1978 ; |
|
~%
9,10-Anthracene... CAS#:6937-75-3 |
| Literature: Bayer and Co. Patent: DE147851 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 7, p. 177 |
|
~%
9,10-Anthracene... CAS#:6937-75-3 |
| Literature: Spada Annali di Chimica Applicata, 1940 , vol. 30, p. 438,441 |
|
~%
9,10-Anthracene... CAS#:6937-75-3 |
| Literature: Ullmann; Kertesz Chemische Berichte, 1919 , vol. 52, p. 555 |
|
~%
9,10-Anthracene... CAS#:6937-75-3 |
| Literature: Bayer and Co. Patent: DE147851 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 7, p. 177 |
|
~%
9,10-Anthracene... CAS#:6937-75-3 |
| Literature: Ullmann; Kertesz Chemische Berichte, 1919 , vol. 52, p. 555 |
|
~%
9,10-Anthracene... CAS#:6937-75-3
Detail
|
| Literature: I. G. Farbenind. Patent: DE473871 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1273 |
|
~%
9,10-Anthracene... CAS#:6937-75-3
Detail
|
| Literature: I.G. Farbenind Patent: DE473871 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1272,1273 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| 9,1-amino-5-nitro |
| 1-Amino-5-nitro-anthrachinon |
| Anthraquinone,1-amino-5-nitro |
| 5-Nitro-1-amino-anthrachinon |
| 5-nitro-1-aminoanthraquinone |
| 1-Amino-5-nitroanthraquinone |
| 1,5-Amino-nitroanthrachinon |