[2,2'-Bi-1H-indene]-1,1',3,3'(2H,2'H)-tetrone
![[2,2'-Bi-1H-indene]-1,1',3,3'(2H,2'H)-tetrone Structure](https://image.chemsrc.com/caspic/405/6940-95-0.png)
[2,2'-Bi-1H-indene]-1,1',3,3'(2H,2'H)-tetrone structure
|
Common Name | [2,2'-Bi-1H-indene]-1,1',3,3'(2H,2'H)-tetrone | ||
|---|---|---|---|---|
| CAS Number | 6940-95-0 | Molecular Weight | 290.27000 | |
| Density | 1.475g/cm3 | Boiling Point | 543.1ºC at 760 mmHg | |
| Molecular Formula | C18H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.5ºC | |
Summary: 2-(1,3-Dioxoinden-2-yl)indene-1,3-dione (also known as [2,2'-Bi-1H-indene]-1,1',3,3'(2H,2'H)-tetrone, CAS: 6940-95-0, Molecular Formula: C18H10O4, Molecular Weight: 290.27000), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1,3-dioxoinden-2-yl)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 543.1ºC at 760 mmHg |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27000 |
| Flash Point | 239.5ºC |
| Exact Mass | 290.05800 |
| PSA | 68.28000 |
| LogP | 2.37720 |
| Index of Refraction | 1.692 |
| InChIKey | LRFYPSGRUORTIS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C1C1C(=O)c2ccccc2C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 4 | |
CAS#:65348-39-2
CAS#:123-51-3![3-[2-(3-oxoisobenzofuran-1-ylidene)ethylidene]isobenzofuran-1-one Structure](https://image.chemsrc.com/caspic/052/63187-50-8.png)
CAS#:63187-50-8
CAS#:85-44-9
CAS#:1807-49-4![[1,3-Dioxo-2-indanyliden-hydrazono]-triphenylphosphoran Structure](https://image.chemsrc.com/caspic/280/1060-31-7.png)
CAS#:1060-31-7
CAS#:485-47-2
CAS#:64-17-5
CAS#:5103-42-4
CAS#:73907-80-9
CAS#:606-23-5
CAS#:92-24-0
CAS#:1785-52-0
CAS#:787-61-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [2,2']Biindenyl-1,3,1',3'-tetraon |
| bis-indan-1,3-dione |
| 2,2'-biindanyl-1,1',3,3'-tetraone |
| propylphosphanediyl-bis-methanol |
| Bisdiketohydrinden |
| Methanol,(propylphosphinidene)bis |
| Bis-(1.3-dioxo-hydrindyl-(2)) |
| Bis-hydroxymethyl-propyl-phosphin |
| [2,2']biindenyl-1,3,1',3'-tetraone |
| 1.3.1'.3'-Tetraoxo-dihydrindyl-(2.2') |
| Propyl-bis-hydroxymethyl-phosphin |
| Propyl-dimethylol-phosphin |
| bis-hydroxymethyl-propyl-phosphane |
| Di(hydroxymethyl)propylphosphin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 6940-95-0? |
| A: Chinese name of 6940-95-0 is 6940-95-0. |
| Q: What is the molecular formula of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: Molecular formula of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione is C18H10O4. |
| Q: What are the downstream products of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: Related downstream products(CAS) of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione: 606-23-5;92-24-0;1785-52-0;787-61-1. |
| Q: What is the boiling point of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: Boiling point of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione is 543.1ºC at 760 mmHg. |
| Q: What are the upstream materials of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: Related upstream materials(CAS) of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione: 65348-39-2;123-51-3;63187-50-8;85-44-9;1807-49-4;1060-31-7;485-47-2;64-17-5;5103-42-4;73907-80-9. |
| Q: What is the molecular weight of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: Molecular weight of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione is 290.27000. |
| Q: What is the English name of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: The English name of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione is 2-(1,3-dioxoinden-2-yl)indene-1,3-dione. |
| Q: What is the LogP of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: LogP of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione is 2.37720. |
| Q: What is the SMILES notation of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: SMILES notation of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione is O=C1c2ccccc2C(=O)C1C1C(=O)c2ccccc2C1=O. |
| Q: What is the CAS number of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione? |
| A: CAS number of 2-(1,3-dioxoinden-2-yl)indene-1,3-dione is 6940-95-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |