Hydrindantin structure
|
Common Name | Hydrindantin | ||
|---|---|---|---|---|
| CAS Number | 5103-42-4 | Molecular Weight | 322.268 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 615.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H10O6 | Melting Point | 252ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 339.8±28.0 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 615.0±55.0 °C at 760 mmHg |
| Melting Point | 252ºC (dec.)(lit.) |
| Molecular Formula | C18H10O6 |
| Molecular Weight | 322.268 |
| Flash Point | 339.8±28.0 °C |
| Exact Mass | 322.047729 |
| PSA | 108.74000 |
| LogP | 4.73 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.776 |
| InChIKey | LWFPYLZOVOCBPZ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C1(O)C1(O)C(=O)c2ccccc2C1=O |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914400090 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Dextrin-colistin conjugates as a model bioresponsive treatment for multidrug resistant bacterial infections.
Mol. Pharm. 11(12) , 4437-47, (2014) Polymer therapeutics offer potential benefits in the treatment of multidrug resistant (MDR) infections; affording targeted delivery of biologically active agents to the site of inflammation, potential... |
| [2,2'-Biindan]-1,1',3,3'-tetrone, 2,2'-dihydroxy- |
| EINECS 225-823-4 |
| 2,2'-Dihydroxy-(2,2'-biindan)-1,1',3,3'-tetrone |
| 2,2'-Dihydroxy-1H,1'H-2,2'-biindene-1,1',3,3'(2H,2'H)-tetrone |
| [2,2'-Bi-1H-indene]-1,1',3,3'(2H,2'H)-tetrone, 2,2'-dihydroxy- |
| 2,2',3,3,3',3'-Hexahydroxy-2,2'-biindan-1,1'-dione |
| 2,2'-Dihydroxy-[2,2'-biindan]-1,1',3,3'-tetrone |
| MFCD00003781 |
| 2,2'-Dihydroxy-[2,2'-bi-1H-indene]-1,1',3,3'-(2H,2'H)-tetrone |
| Reduced Ninhydrin |
| Hydrindantin anhydrous |
| Hydrindantin |
| (2,2'-Bi-1H-indene)-1,1',3,3'(2H,2'H)-tetrone, 2,2'-dihydroxy- |