[2-oxo-2-(4-phenylphenyl)ethyl] octanoate structure
|
Common Name | [2-oxo-2-(4-phenylphenyl)ethyl] octanoate | ||
|---|---|---|---|---|
| CAS Number | 6942-70-7 | Molecular Weight | 338.44000 | |
| Density | 1.051g/cm3 | Boiling Point | 470ºC at 760 mmHg | |
| Molecular Formula | C22H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.6ºC | |
| Name | [2-oxo-2-(4-phenylphenyl)ethyl] octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 470ºC at 760 mmHg |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.44000 |
| Flash Point | 203.6ºC |
| Exact Mass | 338.18800 |
| PSA | 43.37000 |
| LogP | 5.44000 |
| Index of Refraction | 1.531 |
| InChIKey | VEJHBNSTZDNKOS-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
[2-oxo-2-(4-phe... CAS#:6942-70-7 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
[2-oxo-2-(4-phe... CAS#:6942-70-7 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
[2-oxo-2-(4-phe... CAS#:6942-70-7 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Biphenyl-4-yl-2-octanoyloxy-aethanon |
| 1-biphenyl-4-yl-2-octanoyloxy-ethanone |