[2-oxo-2-(4-phenylphenyl)ethyl] acetate structure
|
Common Name | [2-oxo-2-(4-phenylphenyl)ethyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 4376-27-6 | Molecular Weight | 254.28100 | |
| Density | 1.141g/cm3 | Boiling Point | 395.9ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.5ºC | |
| Name | [2-oxo-2-(4-phenylphenyl)ethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 395.9ºC at 760 mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 175.5ºC |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 3.09940 |
| Index of Refraction | 1.558 |
| InChIKey | JAVWKTYKNBPSOJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2915390090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| Essigsaeure-<4-phenyl-phenacylester> |
| 2-Acetoxy-1-biphenyl-4-yl-aethanon |
| 2-(biphenyl-4-yl)-2-oxoethyl acetate |
| p-phenylphenacyl acetate |
| 2-acetoxy-4'-phenylacetophenone |
| 2-acetoxy-1-biphenyl-4-yl-ethanone |
| Essigsaeure-<4-phenyl-phenylacylester> |