1-bromo-4-[(4-nitrophenyl)methoxy]benzene structure
|
Common Name | 1-bromo-4-[(4-nitrophenyl)methoxy]benzene | ||
|---|---|---|---|---|
| CAS Number | 6943-02-8 | Molecular Weight | 308.12700 | |
| Density | 1.524g/cm3 | Boiling Point | 430.8ºC at 760 mmHg | |
| Molecular Formula | C13H10BrNO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 214.3ºC | |
| Name | 1-[(4-bromophenoxy)methyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.524g/cm3 |
|---|---|
| Boiling Point | 430.8ºC at 760 mmHg |
| Molecular Formula | C13H10BrNO3 |
| Molecular Weight | 308.12700 |
| Flash Point | 214.3ºC |
| Exact Mass | 306.98400 |
| PSA | 55.05000 |
| LogP | 4.45950 |
| Index of Refraction | 1.626 |
| InChIKey | DNUWJQWWGBYZDF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(COc2ccc(Br)cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~73%
1-bromo-4-[(4-n... CAS#:6943-02-8 |
| Literature: InterMune, Inc. Patent: US2011/152246 A1, 2011 ; Location in patent: Page/Page column 244-245 ; |
|
~%
1-bromo-4-[(4-n... CAS#:6943-02-8 |
| Literature: Powell; Adams Journal of the American Chemical Society, 1920 , vol. 42, p. 655 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (4-Brom-phenyl)-(4-nitro-benzyl)-aether |
| 4-phenoxy-(4'-nitro)-benzylbromide |
| 1-bromo-4-[(4-nitrobenzyl)oxy]benzene |
| (4-bromo-phenyl)-(4-nitro-benzyl)-ether |
| p-Nitrobenzyl-p-bromphenylether |