3-(2-Methoxy-5-nitrophenyl)propenoic acid
3-(2-Methoxy-5-nitrophenyl)propenoic acid structure
|
Common Name | 3-(2-Methoxy-5-nitrophenyl)propenoic acid | ||
|---|---|---|---|---|
| CAS Number | 69447-75-2 | Molecular Weight | 223.18200 | |
| Density | 1.387g/cm3 | Boiling Point | 426.5ºC at 760 mmHg | |
| Molecular Formula | C10H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760 mmHg |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18200 |
| Flash Point | 211.7ºC |
| Exact Mass | 223.04800 |
| PSA | 92.35000 |
| LogP | 2.22440 |
| Index of Refraction | 1.625 |
| InChIKey | PTGPYHUXNRRNOM-GORDUTHDSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1C=CC(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:2725-81-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-nitro-2-methoxy-trans-cinnamic acid |
| 5-Nitro-2-methoxy-trans-zimtsaeure |
| 2-Methoxy-5-nitrocinnamic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: The English name of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid. |
| Q: What is the boiling point of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: Boiling point of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is 426.5ºC at 760 mmHg. |
| Q: What is the CAS number of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: CAS number of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is 69447-75-2. |
| Q: What are the downstream products of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: Related downstream products(CAS) of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid: 2725-81-7;69447-75-2. |
| Q: What is the molecular weight of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: Molecular weight of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is 223.18200. |
| Q: What is the polar surface area (PSA) of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: Polar surface area (PSA) of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is 92.35000. |
| Q: What is the molecular formula of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: Molecular formula of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is C10H9NO5. |
| Q: What is the Chinese name of 69447-75-2? |
| A: Chinese name of 69447-75-2 is 69447-75-2. |
| Q: What is the InChIKey of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: InChIKey of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is PTGPYHUXNRRNOM-GORDUTHDSA-N. |
| Q: What is the LogP of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid? |
| A: LogP of (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enoic acid is 2.22440. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |