5-(m-Chlorophenyl)-3-methoxy-1,2,4-triazine structure
|
Common Name | 5-(m-Chlorophenyl)-3-methoxy-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 69467-08-9 | Molecular Weight | 221.64300 | |
| Density | 1.301g/cm3 | Boiling Point | 390.1ºC at 760mmHg | |
| Molecular Formula | C10H8ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.7ºC | |
| Name | 5-(3-chlorophenyl)-3-methoxy-1,2,4-triazine |
|---|
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760mmHg |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.64300 |
| Flash Point | 189.7ºC |
| Exact Mass | 221.03600 |
| PSA | 47.90000 |
| LogP | 2.20060 |
| Index of Refraction | 1.58 |
| InChIKey | HBQQTUZFVAWGRS-UHFFFAOYSA-N |
| SMILES | COc1nncc(-c2cccc(Cl)c2)n1 |
|
~%
5-(m-Chlorophen... CAS#:69467-08-9 |
| Literature: Heilman; Scozzie; Wayner; Gullo; Ariyan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 3 p. 282 - 287 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |