5,6-Diphenyl-3-isopropoxy-1,2,4-triazine structure
|
Common Name | 5,6-Diphenyl-3-isopropoxy-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 69467-21-6 | Molecular Weight | 291.34700 | |
| Density | 1.133g/cm3 | Boiling Point | 430.8ºC at 760 mmHg | |
| Molecular Formula | C18H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.3ºC | |
| Name | 5,6-diphenyl-3-propan-2-yloxy-1,2,4-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 430.8ºC at 760 mmHg |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.34700 |
| Flash Point | 155.3ºC |
| Exact Mass | 291.13700 |
| PSA | 47.90000 |
| LogP | 3.99280 |
| Index of Refraction | 1.58 |
| InChIKey | VEDRKPGPRRBLMN-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
|
~%
5,6-Diphenyl-3-... CAS#:69467-21-6 |
| Literature: Heilman; Scozzie; Wayner; Gullo; Ariyan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 3 p. 282 - 287 |
|
~%
5,6-Diphenyl-3-... CAS#:69467-21-6 |
| Literature: Heilman; Scozzie; Wayner; Gullo; Ariyan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 3 p. 282 - 287 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,6-Diphenyl-3-isopropoxy-as-triazine |
| 3-isopropoxy-5,6-diphenyl-1,2,4-triazine |
| as-Triazine,5,6-diphenyl-3-isopropoxy |
| 3-Isopropoxy-5,6-diphenyl-1,2,4-triazin |