5,6-Diphenyl-3-phenoxy-1,2,4-triazine structure
|
Common Name | 5,6-Diphenyl-3-phenoxy-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 13163-06-9 | Molecular Weight | 325.36300 | |
| Density | 1.203g/cm3 | Boiling Point | 503.4ºC at 760 mmHg | |
| Molecular Formula | C21H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.6ºC | |
| Name | 3-phenoxy-5,6-diphenyl-1,2,4-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 503.4ºC at 760 mmHg |
| Molecular Formula | C21H15N3O |
| Molecular Weight | 325.36300 |
| Flash Point | 178.6ºC |
| Exact Mass | 325.12200 |
| PSA | 47.90000 |
| LogP | 4.99790 |
| Vapour Pressure | 9.11E-10mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | KIDYNQAPDBOURC-UHFFFAOYSA-N |
| SMILES | c1ccc(Oc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5,6-Diphenyl-3-phenoxy-1,2,4-triazine |
| 5,6-Diphenyl-3-phenoxy-as-triazine |
| 3-Phenoxy-5,6-diphenyl-1,2,4-triazin |
| 1,2,4-Triazine,3-phenoxy-5,6-diphenyl |
| as-Triazine,5,6-diphenyl-3-phenoxy |