(DICHLOROIODO)-BENZENE structure
|
Common Name | (DICHLOROIODO)-BENZENE | ||
|---|---|---|---|---|
| CAS Number | 69492-91-7 | Molecular Weight | 279.03200 | |
| Density | 2.021g/cm3 | Boiling Point | 254.4ºC at 760 mmHg | |
| Molecular Formula | C7H6INO3 | Melting Point | 82-84ºC | |
| MSDS | N/A | Flash Point | 107.6ºC | |
| Name | 2-iodo-4-methyl-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.021g/cm3 |
|---|---|
| Boiling Point | 254.4ºC at 760 mmHg |
| Melting Point | 82-84ºC |
| Molecular Formula | C7H6INO3 |
| Molecular Weight | 279.03200 |
| Flash Point | 107.6ºC |
| Exact Mass | 278.93900 |
| PSA | 66.05000 |
| LogP | 2.73660 |
| Index of Refraction | 1.684 |
| InChIKey | ZGSKNXKQYFZYAW-UHFFFAOYSA-N |
| SMILES | Cc1cc(I)c(O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2908999090 |
|
~93%
(DICHLOROIODO)-... CAS#:69492-91-7 |
| Literature: Kajigaeshi, Shoji; Kakinami, Takaaki; Yamasaki, Hiromichi; Fujisaki, Shizuo; Kondo, Manabu; Okamoto, Tsuyoshi Chemistry Letters, 1987 , p. 2109 - 2112 |
|
~36%
(DICHLOROIODO)-... CAS#:69492-91-7 |
| Literature: Canadian Journal of Chemistry, , vol. 67, p. 104 - 108 |
|
~%
(DICHLOROIODO)-... CAS#:69492-91-7 |
| Literature: Journal of the American Chemical Society, , vol. 39, p. 452 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 5-Jod-3-nitro-4-oxy-toluol |
| 2-iodanyl-4-methyl-6-nitro-phenol |
| 2-iodo-4-methyl-6-nitro-phenol |
| 6-Iod-4-methyl-2-nitrophenol |
| 6-Jod-2-nitro-p-kresol |
| 2-Jod-4-methyl-6-nitro-phenol |