Guanidine,N-(2-hydroxypropyl)-N'-nitro- structure
|
Common Name | Guanidine,N-(2-hydroxypropyl)-N'-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6950-16-9 | Molecular Weight | 162.14700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxypropyl)-1-nitroguanidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H10N4O3 |
|---|---|
| Molecular Weight | 162.14700 |
| Exact Mass | 162.07500 |
| PSA | 113.96000 |
| LogP | 0.07760 |
| InChIKey | YSYLKPWBYGXZQE-UHFFFAOYSA-N |
| SMILES | CC(O)CN=C(N)N[N+](=O)[O-] |
|
~%
Guanidine,N-(2-... CAS#:6950-16-9 |
| Literature: McKay; Milks Journal of the American Chemical Society, 1950 , vol. 72, p. 1616,1618 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Nitro-1-<2-hydroxy-propyl>-guanidin |