n-(2,4-difluorophenyl)maleimide structure
|
Common Name | n-(2,4-difluorophenyl)maleimide | ||
|---|---|---|---|---|
| CAS Number | 6954-65-0 | Molecular Weight | 209.14900 | |
| Density | 1.508g/cm3 | Boiling Point | 304.9ºC at 760 mmHg | |
| Molecular Formula | C10H5F2NO2 | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | 138.2ºC | |
| Name | 1-(2,4-difluorophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.508g/cm3 |
|---|---|
| Boiling Point | 304.9ºC at 760 mmHg |
| Melting Point | 83-85ºC |
| Molecular Formula | C10H5F2NO2 |
| Molecular Weight | 209.14900 |
| Flash Point | 138.2ºC |
| Exact Mass | 209.02900 |
| PSA | 37.38000 |
| LogP | 1.45920 |
| Index of Refraction | 1.582 |
| InChIKey | WQAYULVQTJAUMD-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(F)cc1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925190090 |
|
~%
n-(2,4-difluoro... CAS#:6954-65-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 9 p. 2823 - 2834 |
|
~%
n-(2,4-difluoro... CAS#:6954-65-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 9 p. 2823 - 2834 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-(2,4-Difluorophenyl)maleimide |
| N-(2,4-Difluorphenyl)-maleimid |
| 1-(2,4-difluoro-phenyl)-pyrrole-2,5-dione |
| difluorophenylpyrroledione |
| MFCD00033652 |