Bis(p-chlorophenyl)amine structure
|
Common Name | Bis(p-chlorophenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 6962-04-5 | Molecular Weight | 238.11300 | |
| Density | 1.327g/cm3 | Boiling Point | 348.4ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.5ºC | |
| Name | 4-chloro-N-(4-chlorophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 348.4ºC at 760 mmHg |
| Molecular Formula | C12H9Cl2N |
| Molecular Weight | 238.11300 |
| Flash Point | 164.5ºC |
| Exact Mass | 237.01100 |
| PSA | 12.03000 |
| LogP | 4.81000 |
| Index of Refraction | 1.649 |
| InChIKey | PTHWAPQEXRZRJW-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Nc2ccc(Cl)cc2)cc1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| p,p'-Dichlor-diphenylamin |
| 4,4'-dichlorodiphenylamine |
| 4.4'--Dichlor-diphenylamin |
| Diphenylamine,4'-dichloro |