2-tert-butyl-5-methyl-1H-indole structure
|
Common Name | 2-tert-butyl-5-methyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 69622-41-9 | Molecular Weight | 187.28100 | |
| Density | 1.013g/cm3 | Boiling Point | 312.3ºC at 760 mmHg | |
| Molecular Formula | C13H17N | Melting Point | 104-106ºC | |
| MSDS | N/A | Flash Point | 130.8ºC | |
| Name | 2-tert-butyl-5-methyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013g/cm3 |
|---|---|
| Boiling Point | 312.3ºC at 760 mmHg |
| Melting Point | 104-106ºC |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.28100 |
| Flash Point | 130.8ºC |
| Exact Mass | 187.13600 |
| PSA | 15.79000 |
| LogP | 3.77380 |
| Index of Refraction | 1.582 |
| InChIKey | YFVKHVKAHXPBKH-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c(C(C)(C)C)cc2c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~76%
2-tert-butyl-5-... CAS#:69622-41-9 |
| Literature: Chemistry - A European Journal, , vol. 20, # 8 p. 2352 - 2356 |
|
~%
2-tert-butyl-5-... CAS#:69622-41-9 |
| Literature: Gazzetta Chimica Italiana, , vol. 93, p. 1373,1379 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole,2-(1,1-dimethylethyl)-5-methyl |
| 2-t-butyl-5-methylindole |
| 2-tert-butyl-5-methyl-indole |
| 2-(TERT-BUTYL)-5-METHYL-1H-INDOLE |
| 5-Methyl-2-tert-butyl-indol |
| 2-tert-Butyl-5-methyl-indol |