2-tert-butyl-7-methyl-1h-indole structure
|
Common Name | 2-tert-butyl-7-methyl-1h-indole | ||
|---|---|---|---|---|
| CAS Number | 69622-42-0 | Molecular Weight | 187.28100 | |
| Density | 1.013g/cm3 | Boiling Point | 307.4ºC at 760 mmHg | |
| Molecular Formula | C13H17N | Melting Point | 99ºC | |
| MSDS | N/A | Flash Point | 128ºC | |
| Name | 2-tert-butyl-7-methyl-1h-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013g/cm3 |
|---|---|
| Boiling Point | 307.4ºC at 760 mmHg |
| Melting Point | 99ºC |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.28100 |
| Flash Point | 128ºC |
| Exact Mass | 187.13600 |
| PSA | 15.79000 |
| LogP | 3.77380 |
| Index of Refraction | 1.582 |
| InChIKey | WVIIEDLFBUMOFH-UHFFFAOYSA-N |
| SMILES | Cc1cccc2cc(C(C)(C)C)[nH]c12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~65%
2-tert-butyl-7-... CAS#:69622-42-0 |
| Literature: Smith, Keith; El-Hiti, Gamal A.; Pritchard, Gareth J.; Hamilton, Anna Journal of the Chemical Society - Perkin Transactions 1, 1999 , # 16 p. 2299 - 2303 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Methyl-2-tert-butylindole |
| 2-tert-butyl-7-methyl-indole |