1,6-Hexamethylene bis(N,N-dimethylsemicarbazide) structure
|
Common Name | 1,6-Hexamethylene bis(N,N-dimethylsemicarbazide) | ||
|---|---|---|---|---|
| CAS Number | 69938-76-7 | Molecular Weight | 288.390 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 236-237 °C(lit.) | |
| Molecular Formula | C12H28N6O2 | Melting Point | 20-23 °C(lit.) | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 4,4'-Hexamethylenebis(1,1-dimethylsemicarbazide) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 236-237 °C(lit.) |
| Melting Point | 20-23 °C(lit.) |
| Molecular Formula | C12H28N6O2 |
| Molecular Weight | 288.390 |
| Flash Point | >230 °F |
| Exact Mass | 288.227386 |
| PSA | 88.74000 |
| LogP | -0.88 |
| Index of Refraction | 1.499 |
| InChIKey | VETHREXFBVHLJJ-UHFFFAOYSA-N |
| SMILES | CN(C)NC(=O)NCCCCCCNC(=O)NN(C)C |
| Water Solubility | SOLUBLE |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| RTECS | QD9694000 |
| HS Code | 29349990 |
|
~95%
1,6-Hexamethyle... CAS#:69938-76-7 |
| Literature: Shevchenko, V. V.; Klimenko, N. S.; Vasil'evskaya, G. A. Journal of Organic Chemistry USSR (English Translation), 1982 , vol. 18, # 12 p. 2247 - 2248 Zhurnal Organicheskoi Khimii, 1982 , vol. 18, # 12 p. 2547 - 2549 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00089122 |
| Hydrazinecarboxamide, N,N'-1,6-hexanediylbis[2,2-dimethyl- |
| N,N'-Hexane-1,6-diylbis(2,2-dimethylhydrazinecarboxamide) |
| 1-(dimethylamino)-3-[6-(dimethylaminocarbamoylamino)hexyl]urea |
| N,N'-1,6-Hexanediylbis(2,2-dimethylhydrazinecarboxamide) |