1,6-hexamethylene bis-methacrylamide structure
|
Common Name | 1,6-hexamethylene bis-methacrylamide | ||
|---|---|---|---|---|
| CAS Number | 16069-15-1 | Molecular Weight | 252.35300 | |
| Density | 0.965g/cm3 | Boiling Point | 495.8ºC at 760mmHg | |
| Molecular Formula | C14H24N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 186.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,6-hexamethylene bis-methacrylamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 495.8ºC at 760mmHg |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.35300 |
| Flash Point | 186.5ºC |
| Exact Mass | 252.18400 |
| PSA | 58.20000 |
| LogP | 2.71320 |
| Vapour Pressure | 5.73E-10mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | YBKWKURHPIBUEM-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NCCCCCCNC(=O)C(=C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
|
~%
1,6-hexamethyle... CAS#:16069-15-1 |
| Literature: Pritykin,L.M. et al. Journal of Organic Chemistry USSR (English Translation), 1971 , vol. 7, # 9 p. 1938 - 1942 Zhurnal Organicheskoi Khimii, 1971 , vol. 7, # 9 p. 1870 - 1874 |
|
~%
1,6-hexamethyle... CAS#:16069-15-1 |
| Literature: Sokolova,T.A.; Tikhodeeva,I.I. J. Gen. Chem. USSR (Engl. Transl.), 1961 , vol. 31, p. 2222 - 2224,2073 - 2075 |
|
~%
1,6-hexamethyle... CAS#:16069-15-1 |
| Literature: Du PONT de NEMOURS and Co. Patent: US2311548 , 1939 ; |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Hexamethylenebis(methacrylamide) |
| N,N'-(1,6-hexanediyl)bismethacrylamide |
| Einecs 240-214-3 |
| N,N'-Hexandiyl-bis-methacrylamid |
| 1,6-Hexamethylene bis-methyacrylamide |
| N,N'-Dimethacryloyl-hexamethylendiamin |
| Hexamethylen-bismethacrylamid |
| N,N'-hexanediyl-bis-methacrylamide |
| N,N'-(1,6-Hexanediyl)bis(2-methyl-2-propenamide) |
| N,N'-hexamethylenedimethacrylamide |