1,4-dihydroxy-2-(3-oxobutyl)anthracene-9,10-dione structure
|
Common Name | 1,4-dihydroxy-2-(3-oxobutyl)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 69960-30-1 | Molecular Weight | 310.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-dihydroxy-2-(3-oxobutyl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14O5 |
|---|---|
| Molecular Weight | 310.30100 |
| Exact Mass | 310.08400 |
| PSA | 91.67000 |
| LogP | 2.39480 |
| InChIKey | WIRYNJASQBKFAN-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
|
~97%
1,4-dihydroxy-2... CAS#:69960-30-1 |
| Literature: Ayyangar, N R; Argade, A B; Mehendale, A R; Deshpande, V H Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1992 , vol. 31, # 1 p. 3 - 8 |
|
~%
1,4-dihydroxy-2... CAS#:69960-30-1 |
| Literature: Ayyangar, N R; Argade, A B; Mehendale, A R; Deshpande, V H Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1992 , vol. 31, # 1 p. 3 - 8 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(3'-oxo-n-butane) quinizarin |
| 1,4-Dihydroxy-2-(3-oxobutyl)-9,10-anthrachinon |
| 9,10-Anthracenedione,1,4-dihydroxy-2-(3-oxobutyl) |