Isocostic acid structure
|
Common Name | Isocostic acid | ||
|---|---|---|---|---|
| CAS Number | 69978-82-1 | Molecular Weight | 234.33 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 374.0±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.7±10.2 °C | |
Use of Isocostic acidγ-Costic acid (compound 13)is a kind of terpenoid. γ-Costic acid can be obtained by chemical transformation. γ-Costic acid has effective antifeedant and cytotoxic doses with EC50 0.5 μg/ml against L. decemlineata[1]. |
| Name | 2-[(2R,4aR)-4a,8-Dimethyl-1,2,3,4,4a,5,6,7-octahydro-2-naphthalen yl]acrylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | γ-Costic acid (compound 13)is a kind of terpenoid. γ-Costic acid can be obtained by chemical transformation. γ-Costic acid has effective antifeedant and cytotoxic doses with EC50 0.5 μg/ml against L. decemlineata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.0±11.0 °C at 760 mmHg |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33 |
| Flash Point | 273.7±10.2 °C |
| Exact Mass | 234.161987 |
| PSA | 37.30000 |
| LogP | 5.14 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | SGZOYHLQNUSAIL-IUODEOHRSA-N |
| SMILES | C=C(C(=O)O)C1CCC2(C)CCCC(C)=C2C1 |
| Hazard Codes | Xi |
|---|
| 2-Naphthaleneacetic acid, 1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-, (2R,4aR)- |
| 2-[(2R,4aR)-4a,8-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-2-yl]prop-2-enoic acid |
| costic acid |
| 2-[(2R,4aR)-4a,8-Dimethyl-1,2,3,4,4a,5,6,7-octahydro-2-naphthalenyl]acrylic acid |
| Isocostic acid |