hypoxanthine-9-beta-d-arabinofuranoside structure
|
Common Name | hypoxanthine-9-beta-d-arabinofuranoside | ||
|---|---|---|---|---|
| CAS Number | 7013-16-3 | Molecular Weight | 268.23 | |
| Density | 2.08g/cm3 | Boiling Point | 732.8ºC at 760 mmHg | |
| Molecular Formula | C10H12N4O5 | Melting Point | 259-260 °C (lit.) | |
| MSDS | N/A | Flash Point | 397ºC | |
Use of hypoxanthine-9-beta-d-arabinofuranosideArabinosylhypoxanthine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 6H-Purin-6-one, 9-.β.-D-arabinofuranosyl-1,9-dihydro |
|---|---|
| Synonym | More Synonyms |
| Description | Arabinosylhypoxanthine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.08g/cm3 |
|---|---|
| Boiling Point | 732.8ºC at 760 mmHg |
| Melting Point | 259-260 °C (lit.) |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 |
| Flash Point | 397ºC |
| Exact Mass | 268.08100 |
| PSA | 133.75000 |
| Index of Refraction | 1.879 |
| InChIKey | UGQMRVRMYYASKQ-UHTZMRCNSA-N |
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(CO)C(O)C1O |
| Storage condition | −20°C |
| Ara-H |
| Ara-I |
| 9-(b-D-Arabinofuranosyl)hypoxanthine |
| hypoxanthine arabinoside |
| Arabinosylhypoxanthine |
| ARABINOFURANOSYL-HYPOXANTHINE |
| 9-pentofuranosyl-1,9-dihydro-purin-6-one |