1-Bromo-3-methyladamantane structure
|
Common Name | 1-Bromo-3-methyladamantane | ||
|---|---|---|---|---|
| CAS Number | 702-77-2 | Molecular Weight | 229.157 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 243.6±9.0 °C at 760 mmHg | |
| Molecular Formula | C11H17Br | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.7±8.4 °C | |
| Name | 1-bromo-3-methyladamantane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 243.6±9.0 °C at 760 mmHg |
| Molecular Formula | C11H17Br |
| Molecular Weight | 229.157 |
| Flash Point | 103.7±8.4 °C |
| Exact Mass | 228.051361 |
| LogP | 4.51 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | MXAYGTASSPYUJB-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)CC(Br)(C3)C2 |
| HS Code | 2903890090 |
|---|
|
~85%
1-Bromo-3-methy... CAS#:702-77-2 |
| Literature: Henkel, James G.; Hane, Jeffrey T.; Gianutsos, Gerald Journal of Medicinal Chemistry, 1982 , vol. 25, # 1 p. 51 - 56 |
|
~99%
1-Bromo-3-methy... CAS#:702-77-2 |
| Literature: JUSTUS-LIEBIG-UNIVERSITAeT GIESSEN Patent: WO2006/10362 A1, 2006 ; Location in patent: Page/Page column 54-55 ; |
|
~44%
Detail
|
| Literature: Canadian Journal of Chemistry, , vol. 65, p. 2428 - 2433 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-BROMO-1-METHYL-ADAMANTANE |
| 1-bromo methyl-3 adamantane |
| 1-Bromo-3-methyladamantane |
| 1-Methyl-3-bromoadamantane |
| 3-Methyl-adamantyl-(1)-bromid |
| 1-bromo-3-methyl-adamantane |
| 1-Methyl-3-bromadamantan |
| 3-methyl-1-bromoadamantane |