Supercinnamaldehyde structure
|
Common Name | Supercinnamaldehyde | ||
|---|---|---|---|---|
| CAS Number | 70351-51-8 | Molecular Weight | 201.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of SupercinnamaldehydeSupercinnamaldehyde is a potent transient receptor potential ankyrin 1 (TRPA1) activator with an EC50 value of 0.8 μM. Supercinnamaldehyde activates TRPA1 ion channels through covalent modification of cysteines[1]. |
| Name | (3Z)-1-Methyl-3-(2-oxopropylidene)-1,3-dihydro-2H-indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Supercinnamaldehyde is a potent transient receptor potential ankyrin 1 (TRPA1) activator with an EC50 value of 0.8 μM. Supercinnamaldehyde activates TRPA1 ion channels through covalent modification of cysteines[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H11NO2 |
|---|---|
| Molecular Weight | 201.22 |
| Exact Mass | 201.07900 |
| PSA | 37.38000 |
| LogP | 1.70040 |
| InChIKey | CZKBLHCEDVWPRN-YFHOEESVSA-N |
| SMILES | CC(=O)C=C1C(=O)N(C)c2ccccc21 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38-52/53 |
| Safety Phrases | 26-36/37-61 |
| RIDADR | NONH for all modes of transport |
| Bicyclo[3.1.1]heptan-2-one,3-[3-(trimethylsilyl)-2-butenyl] |
| (3E)-1-methyl-3-(2-oxopropyridene)-1,3-dihydro-2H-indol-2-one |
| 3-((E)-3-trimethylsilyl-2-butenyl)bicyclo[3.3.1]-heptan-2-one |