4-nitro-N-(pyridin-2-ylmethylideneamino)aniline structure
|
Common Name | 4-nitro-N-(pyridin-2-ylmethylideneamino)aniline | ||
|---|---|---|---|---|
| CAS Number | 70421-66-8 | Molecular Weight | 242.23300 | |
| Density | 1.28g/cm3 | Boiling Point | 436.3ºC at 760 mmHg | |
| Molecular Formula | C12H10N4O2 | Melting Point | 256-259ºC | |
| MSDS | USA | Flash Point | 217.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 4-nitro-N-(pyridin-2-ylmethylideneamino)anilinePyridine-2-carboxaldehyde 4-nitrophenylhydrazone (PCNPH) is a chromogenic substrate to peroxidase enzymes. Pyridine-2-carboxaldehyde 4-nitrophenylhydrazone can form a purple indamine dye with peroxidase enzymes and peroxides[1]. |
| Name | pyridine-2-carboxaldehyde 4-nitrophenylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Description | Pyridine-2-carboxaldehyde 4-nitrophenylhydrazone (PCNPH) is a chromogenic substrate to peroxidase enzymes. Pyridine-2-carboxaldehyde 4-nitrophenylhydrazone can form a purple indamine dye with peroxidase enzymes and peroxides[1]. |
|---|---|
| Related Catalog | |
| Target |
Peroxidase enzymes[1] |
| References |
[1]. Spyros Theodoropulos, et al. Chromogenic substrate to peroxidase enzymes. US5215890A (example 1) |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760 mmHg |
| Melting Point | 256-259ºC |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.23300 |
| Flash Point | 217.7ºC |
| Exact Mass | 242.08000 |
| PSA | 83.10000 |
| LogP | 3.03200 |
| Index of Refraction | 1.636 |
| InChIKey | JXFHYUCJPGWCFI-ZROIWOOFSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccccn2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinecarbaldehyde (4-nitrophenyl)hydrazone |
| anti-Pyridin-2-aldehyd-4-nitrophenylhydrazon |
| PICOLINALDEHYDE 4-NITROPHENYLHYDRAZONE |
| Pyridine-2-carboxaldehyde 4-nitrophenylhydrazine |
| 2-PYRIDINECARBOXALDEHYDE 4-NITROPHENYLHYDRAZONE |
| MFCD00012100 |
| 2-Pyridinecarbaldehyde (p-nitrophenyl)hydrazone |