2-CHLORO-N-(2,3,4,5,6-PENTAFLUOROPHENYL)ACETAMIDE structure
|
Common Name | 2-CHLORO-N-(2,3,4,5,6-PENTAFLUOROPHENYL)ACETAMIDE | ||
|---|---|---|---|---|
| CAS Number | 70426-73-2 | Molecular Weight | 259.56100 | |
| Density | 1.675g/cm3 | Boiling Point | 266.1ºC at 760 mmHg | |
| Molecular Formula | C8H3ClF5NO | Melting Point | 105-106ºC | |
| MSDS | N/A | Flash Point | 114.8ºC | |
| Name | 2-chloro-N-fluoro-N-(2,3,4,5-tetrafluorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.675g/cm3 |
|---|---|
| Boiling Point | 266.1ºC at 760 mmHg |
| Melting Point | 105-106ºC |
| Molecular Formula | C8H3ClF5NO |
| Molecular Weight | 259.56100 |
| Flash Point | 114.8ºC |
| Exact Mass | 258.98200 |
| PSA | 29.10000 |
| LogP | 2.63240 |
| Index of Refraction | 1.497 |
| InChIKey | IWEYBJZNQNRFSW-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~94%
2-CHLORO-N-(2,3... CAS#:70426-73-2 |
| Literature: Bhatia, Pramila A.; Daanen, Jerome F.; Hakeem, Ahmed A.; Kolasa, Teodozyj; Matulenko, Mark A.; Mortell, Kathleen H.; Patel, Meena V.; Stewart, Andrew O.; Wang, Xueqing; Xia, Zhiren; Zhang, Henry Q. Patent: US2004/29887 A1, 2004 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-N-(pentafluorophenyl)acetamide |
| Chloracet-F-anilid |
| N-(Chloroacetyl)pentafluoroaniline |
| 2-chloranyl-N-fluoranyl-N-[2,3,4,5-tetrakis(fluoranyl)phenyl]ethanamide |