α-Conotoxin PnIA TFA
Modify Date: 2025-09-02 15:53:19
α-Conotoxin PnIA TFA structure
|
Common Name | α-Conotoxin PnIA TFA | ||
|---|---|---|---|---|
| CAS Number | 705300-84-1 | Molecular Weight | 1622.82000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C65H95N19O22S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of α-Conotoxin PnIA TFAα-Conotoxin PnIA, a potent and selective antagonist of the mammalian α7 nAChR, has the potential for the research of neurological conditions such as neuropathic pain and Alzheimer’s disease[1]. |
| Name | α-Conotoxin PnIA |
|---|---|
| Synonym | More Synonyms |
| Description | α-Conotoxin PnIA, a potent and selective antagonist of the mammalian α7 nAChR, has the potential for the research of neurological conditions such as neuropathic pain and Alzheimer’s disease[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C65H95N19O22S4 |
|---|---|
| Molecular Weight | 1622.82000 |
| Exact Mass | 1621.58000 |
| PSA | 744.38000 |
| InChIKey | VUVGEYBNLLGGBG-MVPSLEAZSA-N |
| SMILES | CC(C)CC1NC(=O)C(CO)NC(=O)C2CSSCC(C(N)=O)NC(=O)C(Cc3ccc(O)cc3)NC(=O)C(CC(=O)O)NC(=O)C3CCCN3C(=O)C(CC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CSSCC(NC(=O)CN)C(=O)N2)NC(=O)C2CCCN2C(=O)C2CCCN2C1=O |
| a-conotoxin pnia |