3′-Deoxyuridine structure
|
Common Name | 3′-Deoxyuridine | ||
|---|---|---|---|---|
| CAS Number | 7057-27-4 | Molecular Weight | 228.202 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O5 | Melting Point | 176-177℃ | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3′-Deoxyuridine3′-Deoxyuridine is a potential anticancer and antiviral agent. 3'-deoxyuridine inhibits bovine diarrhoea virus (BVDV) production[1]. |
| Name | 1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 3′-Deoxyuridine is a potential anticancer and antiviral agent. 3'-deoxyuridine inhibits bovine diarrhoea virus (BVDV) production[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | 176-177℃ |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.202 |
| Exact Mass | 228.074615 |
| PSA | 104.55000 |
| LogP | -1.75 |
| Appearance of Characters | Powder | White to Off-white |
| Index of Refraction | 1.603 |
| InChIKey | QOXJRLADYHZRGC-SHYZEUOFSA-N |
| SMILES | O=c1ccn(C2OC(CO)CC2O)c(=O)[nH]1 |
| Storage condition | Refrigerator |
| Water Solubility | Soluble in DMSO, methanol, or water. Also soluble in dichloromethane/n |
| Hazard Codes | Xi |
|---|---|
| HS Code | 29389090 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| 3'-Deoxyuridine |
| Uridine,3'-deoxy |
| 3'-deoxy-uridine |
| 3'-Desoxy-uridin |
| Uridine, 3'-deoxy- |