14beta-Benzoyloxy-2-deacetylbaccatin VI structure
|
Common Name | 14beta-Benzoyloxy-2-deacetylbaccatin VI | ||
|---|---|---|---|---|
| CAS Number | 705973-69-9 | Molecular Weight | 730.75 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 751.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C37H46O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9±26.4 °C | |
Use of 14beta-Benzoyloxy-2-deacetylbaccatin VI14β-Benzoyloxy-2-deacetylbaccatin VI is a xetane-ring-containing taxoid compound isolated from the leaves and stems of Taxus chinensis[1]. |
| Name | (2α,5β,7β,9α,10β,13α,14β)-4,7,9,10,13-Pentaacetoxy-1,2-dihydroxy- 5,20-epoxytax-11-en-14-yl benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | 14β-Benzoyloxy-2-deacetylbaccatin VI is a xetane-ring-containing taxoid compound isolated from the leaves and stems of Taxus chinensis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 751.4±60.0 °C at 760 mmHg |
| Molecular Formula | C37H46O15 |
| Molecular Weight | 730.75 |
| Flash Point | 223.9±26.4 °C |
| Exact Mass | 730.283691 |
| PSA | 207.49000 |
| LogP | 4.52 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | ZZJVBWJAVYPFDJ-PRWXGGKJSA-N |
| SMILES | CC(=O)OC1C2=C(C)C(OC(C)=O)C(OC(=O)c3ccccc3)C(O)(C(O)C3C4(OC(C)=O)COC4CC(OC(C)=O)C3(C)C1OC(C)=O)C2(C)C |
| Hazard Codes | Xi |
|---|
| 7,11-Methano-1H-cyclodeca[3,4]benz[1,2-b]oxete-4,5,6,9,10,11,12,12b-octol, 2a,3,4,4a,5,6,9,10,12,12a-decahydro-4a,8,13,13-tetramethyl-, 4,5,6,9,12b-pentaacetate 10-benzoate, (2aR,4S,4aS,5R,6R,9R,10S,11S,12S,12aR,12bS)- |
| (2α,5β,7β,9α,10β,13α,14β)-4,7,9,10,13-Pentaacetoxy-1,2-dihydroxy-5,20-epoxytax-11-en-14-yl benzoate |