3-chloro-N-(2,6-dichloro-4-nitrophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline structure
|
Common Name | 3-chloro-N-(2,6-dichloro-4-nitrophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 70757-02-7 | Molecular Weight | 475.54800 | |
| Density | 1.826g/cm3 | Boiling Point | 440.3ºC at 760mmHg | |
| Molecular Formula | C13H4Cl3F3N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 3-chloro-N-(2,6-dichloro-4-nitrophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.826g/cm3 |
|---|---|
| Boiling Point | 440.3ºC at 760mmHg |
| Molecular Formula | C13H4Cl3F3N4O6 |
| Molecular Weight | 475.54800 |
| Flash Point | 220.1ºC |
| Exact Mass | 473.91500 |
| PSA | 149.49000 |
| LogP | 7.77640 |
| Index of Refraction | 1.649 |
| InChIKey | MNRTYHQJFMNVIA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Nc2c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c2[N+](=O)[O-])c(Cl)c1 |
|
~%
3-chloro-N-(2,6... CAS#:70757-02-7 |
| Literature: Eli Lilly and Company Patent: US4152460 A1, 1979 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenamine,3-chloro-N-(2,6-dichloro-4-nitrophenyl)-2,6-dinitro-4-(trifluoromethyl) |
| 3-chloro-N-(2,6-dichloro-4-nitrophenyl)-2,6-dinitro-4-(trifluoromethyl)benzenamine |