3-chloro-N-(2,4-difluorophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline structure
|
Common Name | 3-chloro-N-(2,4-difluorophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 70757-03-8 | Molecular Weight | 397.64200 | |
| Density | 1.706g/cm3 | Boiling Point | 350.8ºC at 760 mmHg | |
| Molecular Formula | C13H5ClF5N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166ºC | |
| Name | 3-chloro-N-(2,4-difluorophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.706g/cm3 |
|---|---|
| Boiling Point | 350.8ºC at 760 mmHg |
| Molecular Formula | C13H5ClF5N3O4 |
| Molecular Weight | 397.64200 |
| Flash Point | 166ºC |
| Exact Mass | 396.98900 |
| PSA | 103.67000 |
| LogP | 6.31640 |
| Index of Refraction | 1.589 |
| InChIKey | QKMAXUGJSLYRJH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1Nc1ccc(F)cc1F |
|
~%
3-chloro-N-(2,4... CAS#:70757-03-8 |
| Literature: Eli Lilly and Company Patent: US4152460 A1, 1979 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Chloro-N-(2,4-difluorophenyl)-2,6-dinitro-4-(trifluoromethyl)benzenamine |
| Benzenamine,3-chloro-N-(2,4-difluorophenyl)-2,6-dinitro-4-(trifluoromethyl) |