Diethyl 2-(2-(vinyloxy)ethyl)malonate structure
|
Common Name | Diethyl 2-(2-(vinyloxy)ethyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 71172-76-4 | Molecular Weight | 230.25800 | |
| Density | 1.051g/cm3 | Boiling Point | 292.8ºC at 760 mmHg | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.7ºC | |
| Name | diethyl 2-(2-ethenoxyethyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 292.8ºC at 760 mmHg |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.25800 |
| Flash Point | 123.7ºC |
| Exact Mass | 230.11500 |
| PSA | 61.83000 |
| LogP | 1.27900 |
| Index of Refraction | 1.442 |
| InChIKey | FHBPLNAJCDTIPP-UHFFFAOYSA-N |
| SMILES | C=COCCC(C(=O)OCC)C(=O)OCC |
|
~61%
Diethyl 2-(2-(v... CAS#:71172-76-4 |
| Literature: Krasavtsev, I. I.; Basalkevich, E. D.; Matvienko, L. P.; Lozinskii, M. O. Journal of Organic Chemistry USSR (English Translation), 1986 , p. 1046 - 1048 Zhurnal Organicheskoi Khimii, 1986 , vol. 22, # 6 p. 1163 - 1165 |
|
~%
Diethyl 2-(2-(v... CAS#:71172-76-4 |
| Literature: Cretcher; Koch; Pittenger Journal of the American Chemical Society, 1925 , vol. 47, p. 1174 |
| (2-Vinyloxy-aethyl)-malonsaeure-diaethylester |
| ethyl 2-ethoxycarbonyl-4-vinyloxybutyrate |
| diethyl [2-(vinyloxy)ethyl]malonate |
| (2-Vinyloxy-ethyl)-malonsaeurediethylester |
| (2-vinyloxy-ethyl)-malonic acid diethyl ester |
| Diethyl 2-(2-(vinyloxy)ethyl)malonate |