(5β)-Rosane-5,15,16-triol structure
|
Common Name | (5β)-Rosane-5,15,16-triol | ||
|---|---|---|---|---|
| CAS Number | 7121-99-5 | Molecular Weight | 324.50 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 451.7±15.0 °C at 760 mmHg | |
| Molecular Formula | C20H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.1±15.0 °C | |
Use of (5β)-Rosane-5,15,16-triolErythroxytriol P is a natural product that can be isolated from Erythroxylon[1]. |
| Name | (5β)-Rosane-5,15,16-triol |
|---|---|
| Synonym | More Synonyms |
| Description | Erythroxytriol P is a natural product that can be isolated from Erythroxylon[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.7±15.0 °C at 760 mmHg |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 |
| Flash Point | 199.1±15.0 °C |
| Exact Mass | 324.266449 |
| PSA | 60.69000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | OBDGLMHTEAXTDJ-UHFFFAOYSA-N |
| SMILES | CC1(C(O)CO)CCC2(C)C(CCC3(O)C2CCCC3(C)C)C1 |
| Hazard Codes | Xi |
|---|
| (5β)-Rosane-5,15,16-triol |
| 1,2-Ethanediol, 1-[(2R,4aR,4bS,8aR,10aR)-tetradecahydro-8a-hydroxy-2,4a,8,8-tetramethyl-2-phenanthrenyl]- |