2-Amino-4-(trifluoromethyl)benzamide structure
|
Common Name | 2-Amino-4-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 713-41-7 | Molecular Weight | 204.14900 | |
| Density | 1.418g/cm3 | Boiling Point | 268.6ºC at 760 mmHg | |
| Molecular Formula | C8H7F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.2ºC | |
| Name | 2-Amino-4-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 268.6ºC at 760 mmHg |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.14900 |
| Flash Point | 116.2ºC |
| Exact Mass | 204.05100 |
| PSA | 69.11000 |
| LogP | 2.66800 |
| Index of Refraction | 1.529 |
| InChIKey | OUHZMLIWMQFCIR-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(C(F)(F)F)cc1N |
| HS Code | 2924299090 |
|---|
|
~96%
2-Amino-4-(trif... CAS#:713-41-7 |
| Literature: AMBIT BIOSCIENCES CORP. Patent: US2012/53176 A1, 2012 ; US 20120053176 A1 |
|
~85%
2-Amino-4-(trif... CAS#:713-41-7 |
| Literature: Blackie, Josie A.; Turner, Nicholas J.; Wells, Andrew S. Tetrahedron Letters, 1997 , vol. 38, # 17 p. 3043 - 3046 |
|
~%
2-Amino-4-(trif... CAS#:713-41-7 |
| Literature: Helvetica Chimica Acta, , vol. 45, p. 2226 - 2241 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-4-trifluormethyl-benzoesaeureamid |
| EINECS 211-928-2 |
| 2-amino-4-trifluoromethyl-benzamide |
| 4-Trifluormethylanthranilsaeureamid |
| 4-(trifluoromethyl)anthranilamide |