1,3-Indandione, 2-(3,5-dimethyl-p-hydroxyphenyl)-2-hydroxy- structure
|
Common Name | 1,3-Indandione, 2-(3,5-dimethyl-p-hydroxyphenyl)-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 71313-20-7 | Molecular Weight | 282.29100 | |
| Density | 1.396g/cm3 | Boiling Point | 517.2ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.7ºC | |
| Name | 2-hydroxy-2-(4-hydroxy-3,5-dimethylphenyl)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 517.2ºC at 760 mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 280.7ºC |
| Exact Mass | 282.08900 |
| PSA | 74.60000 |
| LogP | 2.27580 |
| Index of Refraction | 1.677 |
| InChIKey | WWCSFRRQCULQOK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C2(O)C(=O)c3ccccc3C2=O)cc(C)c1O |
|
~44%
1,3-Indandione,... CAS#:71313-20-7 |
| Literature: Song, Hyun Nam; Seong, Mi Ra; Lee, Hong Jung; Kim, Jae Nyoung Synthetic Communications, 1999 , vol. 29, # 16 p. 2759 - 2767 |
|
~25%
1,3-Indandione,... CAS#:71313-20-7
Detail
|
| Literature: Courant, Jacqueline; Leblois, Danielle; Tandon, Manju; Robert-Piessard, Sylvie; le Baut, Guillaume; et al. European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 145 - 154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hydroxy-2(hydroxy-4 dimethyl-3,5 phenyl)-2 indanedione-1,3 |
| 2-hydroxy-2-(4-hydroxy-3,5-dimethyl-phenyl)-indan-1,3-dione |
| 1,3-Indandione,2-(3,5-dimethyl-p-hydroxyphenyl)-2-hydroxy |
| 2-(3,5-Dimethyl-p-hydroxyphenyl)-2-hydroxy-1,3-indandione |