methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate structure
|
Common Name | methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 715-33-3 | Molecular Weight | 339.96500 | |
| Density | 1.967g/cm3 | Boiling Point | 307.4ºC at 760 mmHg | |
| Molecular Formula | C9H8Br2O4 | Melting Point | 109-111ºC | |
| MSDS | N/A | Flash Point | 139.7ºC | |
| Name | methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.967g/cm3 |
|---|---|
| Boiling Point | 307.4ºC at 760 mmHg |
| Melting Point | 109-111ºC |
| Molecular Formula | C9H8Br2O4 |
| Molecular Weight | 339.96500 |
| Flash Point | 139.7ºC |
| Exact Mass | 337.87900 |
| PSA | 66.76000 |
| LogP | 2.71780 |
| Index of Refraction | 1.636 |
| InChIKey | OKALYLLBFOYLQB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)c(Br)c(O)c(Br)c1O |
|
~%
methyl 3,5-dibr... CAS#:715-33-3 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 125, p. 359 Justus Liebigs Annalen der Chemie, , vol. 149, p. 293 |
|
~%
methyl 3,5-dibr... CAS#:715-33-3 |
| Literature: Journal of the Chemical Society, , p. 2908 - 2914 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3.5-Dibrom-orsellinsaeuremethylester |
| 3,5-dibromo-2,4-dihydroxy-6-methyl-benzoic acid methyl ester |
| eso-Dibrom-orsellinsaeure-methylester |
| 3.5-Dibrom-2.4-dihydroxy-6-methyl-benzoesaeure-methylester |
| MFCD00082715 |