1-Methyl-3-(3-oxo-1-cyclohexen-1-yl)-2-azepanone structure
|
Common Name | 1-Methyl-3-(3-oxo-1-cyclohexen-1-yl)-2-azepanone | ||
|---|---|---|---|---|
| CAS Number | 71556-70-2 | Molecular Weight | 221.296 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 402.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | 109-110ºC | |
| MSDS | N/A | Flash Point | 184.2±21.1 °C | |
| Name | 1-methyl-3-(3-oxocyclohexen-1-yl)azepan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.1±45.0 °C at 760 mmHg |
| Melting Point | 109-110ºC |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.296 |
| Flash Point | 184.2±21.1 °C |
| Exact Mass | 221.141586 |
| PSA | 37.38000 |
| LogP | 0.90 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | XJZQHHIPUDRJGJ-UHFFFAOYSA-N |
| SMILES | CN1CCCCC(C2=CC(=O)CCC2)C1=O |
| HS Code | 2933790090 |
|---|
|
~%
1-Methyl-3-(3-o... CAS#:71556-70-2 |
| Literature: John Wyeth and Brother Limited Patent: US4197241 A1, 1980 ; |
|
~%
1-Methyl-3-(3-o... CAS#:71556-70-2 |
| Literature: John Wyeth and Brother Limited Patent: US4197241 A1, 1980 ; |
|
~%
1-Methyl-3-(3-o... CAS#:71556-70-2 |
| Literature: Bradley; Cavalla; Edington; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 4 p. 375 - 385 |
|
~%
1-Methyl-3-(3-o... CAS#:71556-70-2 |
| Literature: Bradley; Cavalla; Edington; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 4 p. 375 - 385 |
| Precursor 6 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| 1-Methyl-3-(3-oxocyclohex-1-en-1-yl)azepan-2-one |
| hexahydro-1-methyl-3-(3-oxocyclohexen-1-yl)-2H-azepin-2-one |
| 1-Methyl-3-(3-oxo-1-cyclohexen-1-yl)-2-azepanone |
| 2H-Azepin-2-one, hexahydro-1-methyl-3-(3-oxo-1-cyclohexen-1-yl)- |
| Hexahydro-1-methyl-3-(3-oxo-1-cyclohexen-1-yl)-2H-azepin-2-one |
| QC-1538 |
| EINECS 275-618-9 |
| hexahydro-1-methyl-3-(3-oxo-cyclohex-1-enyl)azepin-2-one |