Z-Phe-Ala-diazomethylketone structure
|
Common Name | Z-Phe-Ala-diazomethylketone | ||
|---|---|---|---|---|
| CAS Number | 71732-53-1 | Molecular Weight | 394.42400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-Phe-Ala-diazomethylketoneZ-Phe-Ala-diazomethylketone binds directly to Aβ42 monomers and small oligomers. Z-Phe-Ala-diazomethylketone inhibits the formation of Aβ42 dodecamers and inhibits Aβ42 fibril formation in the solution. Z-Phe-Ala-diazomethylketone has the potential for neurodegenerative disorders research[1]. |
| Name | (Z,3S)-1-diazonio-3-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]but-1-en-2-olate |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Phe-Ala-diazomethylketone binds directly to Aβ42 monomers and small oligomers. Z-Phe-Ala-diazomethylketone inhibits the formation of Aβ42 dodecamers and inhibits Aβ42 fibril formation in the solution. Z-Phe-Ala-diazomethylketone has the potential for neurodegenerative disorders research[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C21H22N4O4 |
|---|---|
| Molecular Weight | 394.42400 |
| Exact Mass | 394.16400 |
| PSA | 125.62000 |
| LogP | 4.19848 |
| InChIKey | QMPATRQNERZOMF-YJBOKZPZSA-N |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)C=[N+]=[N-] |
| Storage condition | -15°C |
| Z-Phe-Ala-DMK |
| Carbamic acid,((1S)-2-(((1S)-3-diazo-1-methyl-2-oxopropyl)amino)-2-oxo-1-(phenylmethyl)ethyl)-,phenylmethyl ester,(S-(R*,R*)) |
| Carbobenzoxycarbonyl-L-phenylalanyl-L-alanine-D-diazomethane |
| Z-Phe-Ala-Diazomethylketone |
| Benzyloxycarbonylphenylalanylalanine diazomethyl ketone |
| Z-F--DMK |
| Z-Phe-ala-diazomethane |
| Carbamic acid,(2-((3-diazo-1-methyl-2-oxopropyl)amino)-2-oxo-1-(phenylmethyl)ethyl)-,phenylmethyl ester,(S-(R*,R*)) |