12(S)-HPETE structure
|
Common Name | 12(S)-HPETE | ||
|---|---|---|---|---|
| CAS Number | 71774-10-2 | Molecular Weight | 336.47 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 518.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.6±23.6 °C | |
Use of 12(S)-HPETE12(S)-HPETE is a 12-hydroxyeicosatetraenoic acid. 12(S)-HPETE has the function of regulating vascular tone. 12(S)-HPETE may play a physiological role in vasomotor regulation through endothelium itself and crosstalk between blood cells and endothelium. 12(S)-HPETE can be used in the study of cerebrovascular tension [1]. |
| Name | (12S)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 12(S)-HPETE is a 12-hydroxyeicosatetraenoic acid. 12(S)-HPETE has the function of regulating vascular tone. 12(S)-HPETE may play a physiological role in vasomotor regulation through endothelium itself and crosstalk between blood cells and endothelium. 12(S)-HPETE can be used in the study of cerebrovascular tension [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 518.0±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 |
| Flash Point | 175.6±23.6 °C |
| Exact Mass | 336.230072 |
| PSA | 66.76000 |
| LogP | 6.26 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | ZIOZYRSDNLNNNJ-XMWPZNECSA-N |
| SMILES | CCCCCC=CCC(C=CC=CCC=CCCCC(=O)O)OO |
| (5Z,8Z,10E,12S,14Z)-12-Hydroperoxy-5,8,10,14-icosatetraenoic acid |
| 5,8,10,14-Eicosatetraenoic acid, 12-hydroperoxy-, (5Z,8Z,10E,12S,14Z)- |
| 12(S)-HPETE |