Kaempferol 3,4'-di-O-glucoside structure
|
Common Name | Kaempferol 3,4'-di-O-glucoside | ||
|---|---|---|---|---|
| CAS Number | 71939-16-7 | Molecular Weight | 610.51700 | |
| Density | 1.82±0.1 g/cm3(Predicted) | Boiling Point | 984.7±65.0 °C(Predicted) | |
| Molecular Formula | C27H30O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Kaempferol 3,4'-di-O-glucosideKaempferol 3,4'-diglucoside is a flavonol isolated from the aqueous methanolic extract of norway spruce buds. Kaempferol 3,4'-diglucoside is identified in the needles[1]. |
| Name | kaempferol 3,4'-di-O-Glc |
|---|---|
| Synonym | More Synonyms |
| Description | Kaempferol 3,4'-diglucoside is a flavonol isolated from the aqueous methanolic extract of norway spruce buds. Kaempferol 3,4'-diglucoside is identified in the needles[1]. |
|---|---|
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.82±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 984.7±65.0 °C(Predicted) |
| Molecular Formula | C27H30O16 |
| Molecular Weight | 610.51700 |
| Exact Mass | 610.15300 |
| PSA | 269.43000 |
| InChIKey | CRHCCDOCWGWLSH-KBGHMCAJSA-N |
| SMILES | O=c1c(OC2OC(CO)C(O)C(O)C2O)c(-c2ccc(OC3OC(CO)C(O)C(O)C3O)cc2)oc2cc(O)cc(O)c12 |
| Storage condition | -20°C |
| 5,7-Dihydroxy-3-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxy)-2-[4-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxy)-phenyl]-chromen-4-one |
| kaempferol 3,4'-di-O-β-glucopyranoside |
| kaempferol 3,4'-O-β-diglucopyranoside |
| kaempferol-3,4'-O-β-D-diglucopyranoside |
| kaempferol 3,4'-di-O-β-D-glucopyranoside |
| kaempferol-3,4′-di-O-β-D-glucopyranoside |