Kaempferol 3,7-di-O-glucoside structure
|
Common Name | Kaempferol 3,7-di-O-glucoside | ||
|---|---|---|---|---|
| CAS Number | 25615-14-9 | Molecular Weight | 610.51700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H30O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Kaempferol 3,7-di-O-glucosideKaempferol-3,7-di-O-β-glucoside (Kaempferol 3,7-diglucoside), a flavonol, possesses enzyme inhibition property towards α-amylase, α-glucosidase and Acetylcholinesterase. Kaempferol-3,7-di-O-β-glucoside protects differentiating neuronal cells, SH-SY5Y from Amyloid β peptide-induced injury. Kaempferol-3,7-di-O-β-glucoside has the potential for Alzheimer's research[1]. |
| Name | kaempferol-3-O-β-D-glucopyranosyl-7-O-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Kaempferol-3,7-di-O-β-glucoside (Kaempferol 3,7-diglucoside), a flavonol, possesses enzyme inhibition property towards α-amylase, α-glucosidase and Acetylcholinesterase. Kaempferol-3,7-di-O-β-glucoside protects differentiating neuronal cells, SH-SY5Y from Amyloid β peptide-induced injury. Kaempferol-3,7-di-O-β-glucoside has the potential for Alzheimer's research[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Kaempferol-3,7-di-O-β-glucoside (Kaempferol 3,7-diglucoside; 0.1, 100 μM) has effective inhibition in Aβ1-42 fibril formation. Kaempferol-3,7-di-O-β-glucoside has less neurotoxicity on the cultured SH-SY5Y cells[1]. |
| References |
| Molecular Formula | C27H30O16 |
|---|---|
| Molecular Weight | 610.51700 |
| Exact Mass | 610.15300 |
| PSA | 269.43000 |
| InChIKey | XFFQVRFGLSBFON-DEFKTLOSSA-N |
| SMILES | O=c1c(OC2OC(CO)C(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(OC3OC(CO)C(O)C(O)C3O)cc(O)c12 |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| kaempferol 7-O-β-glucopyranosyl 3-O-β-glucopyranoside |
| kaempferol 3,7-O-β-D-diglucopyranoside |
| kaempferol-3,7-di-O-β-D-glucopyranoside |
| KAEMPFEROL-3,7-DI-O-GLUCOSIDE |
| kaempferol 3,7-di-O-β-D-glucopyranoside |