2-(3,4-dimethoxybenzoyl)-4,5-dimethoxy-benzoic acid structure
|
Common Name | 2-(3,4-dimethoxybenzoyl)-4,5-dimethoxy-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 7249-36-7 | Molecular Weight | 346.33100 | |
| Density | 1.254g/cm3 | Boiling Point | 560.9ºC at 760 mmHg | |
| Molecular Formula | C18H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | 2-(3,4-dimethoxybenzoyl)-4,5-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 560.9ºC at 760 mmHg |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.33100 |
| Flash Point | 203.1ºC |
| Exact Mass | 346.10500 |
| PSA | 91.29000 |
| LogP | 2.65020 |
| Index of Refraction | 1.563 |
| InChIKey | DCIJLUSGKMBLPE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2cc(OC)c(OC)cc2C(=O)O)cc1OC |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3',4,4',5-Tetramethoxy-2-benzoylbenzoesaeure |
| 6-Veratroyl-veratrumsaeure |
| 4,5-Dimethoxy-2-veratroyl-benzoesaeure |
| 4,5-dimethoxy-2-veratroyl-benzoic acid |