Benzophenone, 3,3,4,4-tetramethoxy- structure
|
Common Name | Benzophenone, 3,3,4,4-tetramethoxy- | ||
|---|---|---|---|---|
| CAS Number | 4131-03-7 | Molecular Weight | 302.32200 | |
| Density | 1.147g/cm3 | Boiling Point | 456.4ºC at 760 mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202ºC | |
| Name | 3,3',4,4'-Tetramethoxybenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 456.4ºC at 760 mmHg |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32200 |
| Flash Point | 202ºC |
| Exact Mass | 302.11500 |
| PSA | 53.99000 |
| LogP | 2.95200 |
| Index of Refraction | 1.54 |
| InChIKey | HSVLSGPNFMVFOY-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(OC)c(OC)c2)cc1OC |
| HS Code | 2914509090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4-dimethoxy-3,'4'-dimethoxybenzophenone |
| 3,4,3',4'-Tetramethoxy-benzophenon |
| 3,4,3',4'-tetramethoxy-benzophenone |
| bis(3,4-diMethoxyphenyl)Methanone |