2-[2-(3-nitrophenyl)ethenyl]quinoline structure
|
Common Name | 2-[2-(3-nitrophenyl)ethenyl]quinoline | ||
|---|---|---|---|---|
| CAS Number | 7251-91-4 | Molecular Weight | 276.28900 | |
| Density | 1.304g/cm3 | Boiling Point | 455.4ºC at 760 mmHg | |
| Molecular Formula | C17H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2ºC | |
| Name | 2-[2-(3-nitrophenyl)ethenyl]quinoline |
|---|
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 455.4ºC at 760 mmHg |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.28900 |
| Flash Point | 229.2ºC |
| Exact Mass | 276.09000 |
| PSA | 58.71000 |
| LogP | 4.83660 |
| Index of Refraction | 1.748 |
| InChIKey | URIXDBULDXTIHZ-CSKARUKUSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=Cc2ccc3ccccc3n2)c1 |
|
~%
2-[2-(3-nitroph... CAS#:7251-91-4 |
| Literature: Gulakova; Sitin; Kuz'Mina; Fedorova Russian Journal of Organic Chemistry, 2011 , vol. 47, # 2 p. 245 - 252 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |