4(1H)-Pyrimidinone,2-amino-5-nitro structure
|
Common Name | 4(1H)-Pyrimidinone,2-amino-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 7254-29-7 | Molecular Weight | 156.10000 | |
| Density | 2.02g/cm3 | Boiling Point | 417.2ºC at 760 mmHg | |
| Molecular Formula | C4H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | 2-amino-5-nitro-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 417.2ºC at 760 mmHg |
| Molecular Formula | C4H4N4O3 |
| Molecular Weight | 156.10000 |
| Flash Point | 206.1ºC |
| Exact Mass | 156.02800 |
| PSA | 117.59000 |
| LogP | 0.36470 |
| Index of Refraction | 1.798 |
| InChIKey | XQMCRIHJUALWCL-UHFFFAOYSA-N |
| SMILES | Nc1ncc([N+](=O)[O-])c(=O)[nH]1 |
|
~85%
4(1H)-Pyrimidin... CAS#:7254-29-7 |
| Literature: Mittapalli, Gopi Kumar; Osornio, Yazmin M.; Guerrero, Miguel A.; Reddy, Kondreddi Ravinder; Krishnamurthy, Ramanarayanan; Eschenmoser, Albert Angewandte Chemie - International Edition, 2007 , vol. 46, # 14 p. 2478 - 2484 |
|
~%
4(1H)-Pyrimidin... CAS#:7254-29-7 |
| Literature: Brown Journal of the Chemical Society, 1959 , p. 3647 |
| 2-Amino-5-nitro-3H-pyrimidin-4-on |
| 2-amino-5-nitro-3H-pyrimidin-4-one |
| 2-amino-5-nitro-4-oxopyrimidine |
| 2-amino-5-nitro-3,4-dihydropyrimidin-4-one |
| 5-nitroisocytosine |
| 2-Amino-5-nitro-4-oxopyrimidin |