4(1H)-Pyrimidinone,2-amino-5-nitro
4(1H)-Pyrimidinone,2-amino-5-nitro structure
|
Common Name | 4(1H)-Pyrimidinone,2-amino-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 7254-29-7 | Molecular Weight | 156.10000 | |
| Density | 2.02g/cm3 | Boiling Point | 417.2ºC at 760 mmHg | |
| Molecular Formula | C4H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-5-nitro-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 417.2ºC at 760 mmHg |
| Molecular Formula | C4H4N4O3 |
| Molecular Weight | 156.10000 |
| Flash Point | 206.1ºC |
| Exact Mass | 156.02800 |
| PSA | 117.59000 |
| LogP | 0.36470 |
| Index of Refraction | 1.798 |
| InChIKey | XQMCRIHJUALWCL-UHFFFAOYSA-N |
| SMILES | Nc1ncc([N+](=O)[O-])c(=O)[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
4(1H)-Pyrimidin... CAS#:7254-29-7 |
| Literature: Mittapalli, Gopi Kumar; Osornio, Yazmin M.; Guerrero, Miguel A.; Reddy, Kondreddi Ravinder; Krishnamurthy, Ramanarayanan; Eschenmoser, Albert Angewandte Chemie - International Edition, 2007 , vol. 46, # 14 p. 2478 - 2484 |
|
~%
4(1H)-Pyrimidin... CAS#:7254-29-7 |
| Literature: Brown Journal of the Chemical Society, 1959 , p. 3647 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:611-08-5
CAS#:160948-35-6
CAS#:77994-12-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-5-nitro-3H-pyrimidin-4-on |
| 2-amino-5-nitro-3H-pyrimidin-4-one |
| 2-amino-5-nitro-4-oxopyrimidine |
| 2-amino-5-nitro-3,4-dihydropyrimidin-4-one |
| 5-nitroisocytosine |
| 2-Amino-5-nitro-4-oxopyrimidin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: Molecular weight of 2-amino-5-nitro-1H-pyrimidin-6-one is 156.10000. |
| Q: What is the LogP of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: LogP of 2-amino-5-nitro-1H-pyrimidin-6-one is 0.36470. |
| Q: What are the upstream materials of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: Related upstream materials(CAS) of 2-amino-5-nitro-1H-pyrimidin-6-one: 108-53-2. |
| Q: What is the InChIKey of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: InChIKey of 2-amino-5-nitro-1H-pyrimidin-6-one is XQMCRIHJUALWCL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: SMILES notation of 2-amino-5-nitro-1H-pyrimidin-6-one is Nc1ncc([N+](=O)[O-])c(=O)[nH]1. |
| Q: What is the English name of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: The English name of 2-amino-5-nitro-1H-pyrimidin-6-one is 2-amino-5-nitro-1H-pyrimidin-6-one. |
| Q: What is the CAS number of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: CAS number of 2-amino-5-nitro-1H-pyrimidin-6-one is 7254-29-7. |
| Q: What is the molecular formula of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: Molecular formula of 2-amino-5-nitro-1H-pyrimidin-6-one is C4H4N4O3. |
| Q: What is the boiling point of 2-amino-5-nitro-1H-pyrimidin-6-one? |
| A: Boiling point of 2-amino-5-nitro-1H-pyrimidin-6-one is 417.2ºC at 760 mmHg. |
| Q: What English synonyms does 2-amino-5-nitro-1H-pyrimidin-6-one have? |
| A: English synonyms of 2-amino-5-nitro-1H-pyrimidin-6-one: 2-Amino-5-nitro-3H-pyrimidin-4-on, 2-amino-5-nitro-3H-pyrimidin-4-one, 2-amino-5-nitro-4-oxopyrimidine, 2-amino-5-nitro-3,4-dihydropyrimidin-4-one, 5-nitroisocytosine, 2-Amino-5-nitro-4-oxopyrimidin. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |