1-Nonen-3-one,1-(3-nitrophenyl)-, (E)- (9CI) structure
|
Common Name | 1-Nonen-3-one,1-(3-nitrophenyl)-, (E)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 72570-90-2 | Molecular Weight | 261.31600 | |
| Density | 1.096g/cm3 | Boiling Point | 405.7ºC at 760mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.5ºC | |
| Name | (E)-1-(3-nitrophenyl)non-1-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 405.7ºC at 760mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 181.5ºC |
| Exact Mass | 261.13600 |
| PSA | 62.89000 |
| LogP | 4.67070 |
| Index of Refraction | 1.554 |
| InChIKey | UPBYAGXWSZFLMA-ZHACJKMWSA-N |
| SMILES | CCCCCCC(=O)C=Cc1cccc([N+](=O)[O-])c1 |
|
~%
1-Nonen-3-one,1... CAS#:72570-90-2 |
| Literature: Dimmock; Nyathi; Smith Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 10 p. 1216 - 1221 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (E)-1-(3-Nitrophenyl)-1-nonen-3-on |