1-Nonen-3-one,1-(4-methoxyphenyl)-, (E)- (9CI) structure
|
Common Name | 1-Nonen-3-one,1-(4-methoxyphenyl)-, (E)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 74975-53-4 | Molecular Weight | 246.34500 | |
| Density | 0.983g/cm3 | Boiling Point | 388ºC at 760mmHg | |
| Molecular Formula | C16H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | (E)-1-(4-methoxyphenyl)non-1-en-3-one |
|---|
| Density | 0.983g/cm3 |
|---|---|
| Boiling Point | 388ºC at 760mmHg |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.34500 |
| Flash Point | 164.1ºC |
| Exact Mass | 246.16200 |
| PSA | 26.30000 |
| LogP | 4.24790 |
| Index of Refraction | 1.523 |
| InChIKey | ROONRUUQJRGHNB-DHZHZOJOSA-N |
| SMILES | CCCCCCC(=O)C=Cc1ccc(OC)cc1 |
|
~%
1-Nonen-3-one,1... CAS#:74975-53-4 |
| Literature: Heilbron; Irving Journal of the Chemical Society, 1929 , p. 941 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |