N-[(5-nitro-2-furyl)methylideneamino]aniline structure
|
Common Name | N-[(5-nitro-2-furyl)methylideneamino]aniline | ||
|---|---|---|---|---|
| CAS Number | 726-50-1 | Molecular Weight | 231.20700 | |
| Density | 1.32g/cm3 | Boiling Point | 382.1ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | (Z)-1-((5-nitrofuran-2-yl)methylene)-2-phenylhydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760 mmHg |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.20700 |
| Flash Point | 184.9ºC |
| Exact Mass | 231.06400 |
| PSA | 83.35000 |
| LogP | 3.23000 |
| Index of Refraction | 1.622 |
| InChIKey | HUZCMQIIFYRKFJ-WQLSENKSSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2ccccc2)o1 |
| HS Code | 2934999090 |
|---|
|
~%
N-[(5-nitro-2-f... CAS#:726-50-1 |
| Literature: Rio, Maria D. del; Ojeda, Olga D. de; Urquia, M.; Scarabino, Carlos; Yunes, Rosendo A. Australian Journal of Chemistry, 1980 , vol. 33, # 3 p. 519 - 525 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Furaldoxime,5-nitro |
| 5-nitrofurfuraldoxime |
| 5-nitrofuran-2-carboxaldehyde |
| 5-nitro-2-furaldoxim |
| 5-nitro-2-furaldehyde phenylhydrazone |
| 5-nitro-2-furaldehydoxime |
| 5-Nitro-furan-2-carbaldehyd-phenylhydrazon |
| Nitrofuroxime |
| Micofur |
| usafea-5 |
| 5-nitro-2-furaldehyde oxime |
| anti-5-nitro-furfuraldoxime |
| 5-nitro-furan-2-carbaldehyde phenylhydrazone |